Methyl 5-broMo-2-Methylnicotinate manufacturers
|
| | Methyl 5-broMo-2-Methylnicotinate Basic information |
| Product Name: | Methyl 5-broMo-2-Methylnicotinate | | Synonyms: | Methyl 5-broMo-2-Methylnicotinate;1-oleoyl-2-[12-biotinyl(aminododecanoyl)]-sn-glycero-3-phosphoinositol-3,4,5-trisphosphate;3-Pyridinecarboxylic acid, 5-bromo-2-methyl-, methyl ester;5-Bromo-2-methyl-nicotinic acid methyl ester | | CAS: | 1215916-40-7 | | MF: | C8H8BrNO2 | | MW: | 230.06 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 1215916-40-7.mol |  |
| | Methyl 5-broMo-2-Methylnicotinate Chemical Properties |
| Boiling point | 245.2±35.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 1.56±0.20(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H8BrNO2/c1-5-7(8(11)12-2)3-6(9)4-10-5/h3-4H,1-2H3 | | InChIKey | UZSAODVBMBLKCX-UHFFFAOYSA-N | | SMILES | C1(C)=NC=C(Br)C=C1C(OC)=O |
| | Methyl 5-broMo-2-Methylnicotinate Usage And Synthesis |
| | Methyl 5-broMo-2-Methylnicotinate Preparation Products And Raw materials |
|