| Company Name: |
Henan Fengda Chemical Co., Ltd |
| Tel: |
+86-371-86557731 +86-13613820652 |
| Email: |
info@fdachem.com |
| Products Intro: |
Product Name:1,1,2,3,4,5-Hexaphenylsilole CAS:752-28-3 Package:1KG;25kg;200kg;1000kg Elin Remarks:g-kg-tons,free sample is available.Bottle/drum/IBC.Advantage products,new batches,regular stock, ready for shipment.
|
|
|
|
|
|
| | 1,1,2,3,4,5-Hexaphenylsilole Basic information |
| Product Name: | 1,1,2,3,4,5-Hexaphenylsilole | | Synonyms: | 1,1,2,3,4,5-Hexaphenylsilole;1,1,2,3,4,5-Hexaphenyl-1H-silole;Silacyclopenta-2,4-diene, 1,1,2,3,4,5-hexaphenyl-;1,1,2,3,4,5-hexakis-phenylsilole;1,1,2,3,4,5-Hexaphenylsilole>1,1,2,3,4,5-Hexaphenylsilacyclopenta-2,4-diene;1,1,2,3,4,5-Hexaphenyl-1H-silole;Hexaphenylsilole | | CAS: | 752-28-3 | | MF: | C40H30Si | | MW: | 538.75 | | EINECS: | | | Product Categories: | | | Mol File: | 752-28-3.mol |  |
| | 1,1,2,3,4,5-Hexaphenylsilole Chemical Properties |
| Melting point | 193.0 to 197.0 °C | | Boiling point | 674.1±55.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | form | solid | | color | White to Yellow to Green | | λmax | 366nm(Benzene)(lit.) | | InChI | 1S/C40H30Si/c1-7-19-31(20-8-1)37-38(32-21-9-2-10-22-32)40(34-25-13-4-14-26-34)41(35-27-15-5-16-28-35,36-29-17-6-18-30-36)39(37)33-23-11-3-12-24-33/h1-30H | | InChIKey | QAKMXYFDVPDIPT-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=C(C5=CC=CC=C5)[Si]1(C6=CC=CC=C6)C7=CC=CC=C7 | | CAS DataBase Reference | 752-28-3 |
| WGK Germany | WGK 3 | | HS Code | 2934.99.4400 | | Storage Class | 11 - Combustible Solids |
| | 1,1,2,3,4,5-Hexaphenylsilole Usage And Synthesis |
| Uses | Hexaphenylsilacyclopentadiene may undergo π4s+π2s cycloaddition with ethyl acrylate to form bicyclosilaheptene. The same study reports similar cycloaddition reactions with various dienophiles. The reaction of hexaphenylsilacyclopentadiene with perbenzoic acid yields a mixture of tetraphenylfuran and cis-dibenzoylstilbene. | | General Description | HPS is an aggregation-induced emission (AIE) material for use in the OLED emitting layer. Photolysis and thermolysis of 1,4,5,6,7,7-hexaphenyl-7-silabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride (XIb) may lead to the formation of hexaphenylsilacyclopentadiene. |
| | 1,1,2,3,4,5-Hexaphenylsilole Preparation Products And Raw materials |
|