| Company Name: |
Hubei Moco Chemical Co., Ltd. Gold
|
| Tel: |
18627753421; 18627756402 |
| Email: |
3001051413@qq.com |
| Products Intro: |
Product Name:Bromocriptine EP Impurity E
CAS:2492-53-7
Purity:95% HPLC Package:50mg;100mg;200mg;500mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Bromocriptine mesilate EP Impurity E
CAS:2492-53-7
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
BroMocriptine IMpurity E manufacturers
|
| | BroMocriptine IMpurity E Basic information |
| Product Name: | BroMocriptine IMpurity E | | Synonyms: | BroMocriptine IMpurity E;Bromocriptine EP Impurity E;Bromocriptine Impurity 5（Bromocriptine Mesylate EP Impurity E);(6aR,9R)-5-Bromo-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;Bromocriptine Mesylate EP Impurity E;Ergoline-8-carboxamide, 2-bromo-9,10-didehydro-6-methyl-, (8β)- (9CI) | | CAS: | 2492-53-7 | | MF: | C16H16BrN3O | | MW: | 346.22 | | EINECS: | | | Product Categories: | | | Mol File: | 2492-53-7.mol |  |
| | BroMocriptine IMpurity E Chemical Properties |
| Melting point | 215-217 °C(Solv: chloroform (67-66-3)) | | Boiling point | 613.8±55.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | pka | 15.62±0.40(Predicted) | | InChIKey | OZVBMTJYIDMWIL-CCCBMRMVNA-N | | SMILES | C1[C@@H](C(N[C@@]2(O[C@@]3(N([C@H](C(N4[C@@]3([H])CCC4)=O)CC(C)C)C2=O)O)C(C)C)=O)CN(C)[C@]2(C=1C1=C3C(C2)=C(Br)NC3=CC=C1)[H] |&1:1,4,6,8,11,31,r| |
| | BroMocriptine IMpurity E Usage And Synthesis |
| Uses | 2-Bromolysergamide and other Lysergic Acid derivatives are ergopeptides that interact with liver cytochromes P 450. They have also been known to irreversibly inhibit serotonin containing neurons of the raphe nuclei. |
| | BroMocriptine IMpurity E Preparation Products And Raw materials |
|