|
|
| | 5-BroMo-2,4-difluorobenzonitrile Basic information |
| | 5-BroMo-2,4-difluorobenzonitrile Chemical Properties |
| Boiling point | 216.4±35.0 °C(Predicted) | | density | 1.77±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H2BrF2N/c8-5-1-4(3-11)6(9)2-7(5)10/h1-2H | | InChIKey | UXQMPZRISKJUCZ-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(Br)=C(F)C=C1F |
| | 5-BroMo-2,4-difluorobenzonitrile Usage And Synthesis |
| Uses | 5-Bromo-2,4-difluorobenzonitrile is an important intermediate in the agrochemical and pharmaceutical industries. |
| | 5-BroMo-2,4-difluorobenzonitrile Preparation Products And Raw materials |
|