- 1,6-DIVINYLPERFLUOROHEXANE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1800-91-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,6-DIVINYLPERFLUOROHEXANE Basic information |
| Product Name: | 1,6-DIVINYLPERFLUOROHEXANE | | Synonyms: | DAIKIN F-9645;1,6-DIVINYLDODECAFLUOROHEXANE;1,6-DIVINYLPERFLUOROHEXANE;1H,1H,2H,9H,10H,10H-PERFLUORODECA-1,9-DIENE;3,3,4,4,5,5,6,6,7,7,8,8-DODECAFLUORO-1,9-DECADIENE;3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diene;3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluoro-1,9-decadien;1,6-Divinylperfluorohexane 97% | | CAS: | 1800-91-5 | | MF: | C10H6F12 | | MW: | 354.14 | | EINECS: | 217-288-0 | | Product Categories: | | | Mol File: | 1800-91-5.mol |  |
| | 1,6-DIVINYLPERFLUOROHEXANE Chemical Properties |
| Boiling point | 84 °C | | density | 1.506 | | vapor pressure | 12hPa at 20℃ | | refractive index | 1.506 | | Fp | 68°C | | form | liquid | | color | Clear, almost colourless | | Specific Gravity | 1.506 | | Water Solubility | 1.61mg/L at 20℃ | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | InChI | InChI=1S/C10H6F12/c1-3-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)4-2/h3-4H,1-2H2 | | InChIKey | PDFSXHZXNZCKNF-UHFFFAOYSA-N | | SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C | | LogP | 4.18 at 20℃ | | CAS DataBase Reference | 1800-91-5(CAS DataBase Reference) | | EPA Substance Registry System | 1,6-Divinylperfluorohexane (1800-91-5) |
| Hazard Codes | F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | HazardClass | FLAMMABLE | | HS Code | 2916200090 |
| | 1,6-DIVINYLPERFLUOROHEXANE Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | 1,6-DIVINYLPERFLUOROHEXANE Preparation Products And Raw materials |
| Raw materials | 1,6-Diiodododecafluorohexane-->Decane, 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diiodo- |
|