4-Benzoylphenyl Methacrylate manufacturers
|
| | 4-Benzoylphenyl Methacrylate Basic information |
| Product Name: | 4-Benzoylphenyl Methacrylate | | Synonyms: | 4-methacryloyloxy-benzophenone;4-Benzoylphenyl Methacrylate;2-Propenoic acid, 2-methyl-, 4-benzoylphenyl ester;Methacrylic Acid 4-Benzoylphenyl Ester;1kg, OR061795 2-PROPENOIC ACID, 2-METHYL-, 4-BENZOYLPHENYL ESTER;4-benzoylphenyl 2-methylprop-2-enoate | | CAS: | 56467-43-7 | | MF: | C17H14O3 | | MW: | 266.29 | | EINECS: | 611-390-2 | | Product Categories: | | | Mol File: | 56467-43-7.mol |  |
| | 4-Benzoylphenyl Methacrylate Chemical Properties |
| Melting point | 63 °C | | Boiling point | 418.2±24.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | vapor pressure | 0.006Pa at 25℃ | | storage temp. | 2-8°C, stored under nitrogen | | solubility | soluble in Toluene | | form | Solid | | color | White to Light yellow | | InChI | InChI=1S/C17H14O3/c1-12(2)17(19)20-15-10-8-14(9-11-15)16(18)13-6-4-3-5-7-13/h3-11H,1H2,2H3 | | InChIKey | RYWGNBFHIFRNEP-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(C(=O)C2=CC=CC=C2)C=C1)(=O)C(C)=C | | LogP | 3.6 at 25℃ and pH7 |
| | 4-Benzoylphenyl Methacrylate Usage And Synthesis |
| | 4-Benzoylphenyl Methacrylate Preparation Products And Raw materials |
|