|
|
| | Benzyl 5-Hydroxypentanoate Basic information |
| | Benzyl 5-Hydroxypentanoate Chemical Properties |
| Boiling point | 314.8±25.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -86°C Freezer, Under inert atmosphere | | solubility | Acetone (Slightly), Chloroform (Slightly) | | form | Oil | | pka | 15.06±0.10(Predicted) | | color | Colorless to clear Pale Yellow | | Stability: | Temperature Sensitive | | InChI | InChI=1S/C12H16O3/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11/h1-3,6-7,13H,4-5,8-10H2 | | InChIKey | NQTOFIXXPCKZTG-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCCCO |
| | Benzyl 5-Hydroxypentanoate Usage And Synthesis |
| Uses | Benzyl 5-Hydroxypentanoate is used in the synthetic preparation of P2-P1'-linked macrocyclic human renin inhibitors. |
| | Benzyl 5-Hydroxypentanoate Preparation Products And Raw materials |
|