| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane BroMide CAS:795313-24-5 Package:100Mg,1g
|
| Company Name: |
Chemsky(shanghai)International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane BroMide CAS:795313-24-5 Purity:98%
|
| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Aripiprazole Spiro Analog CAS:795313-24-5 Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-C-2814
|
|
| | 8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane BroMide Basic information |
| | 8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane BroMide Chemical Properties |
| Melting point | 237-239°C | | storage temp. | Refrigerator | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C14H19Cl2N2.BrH/c15-12-4-3-5-13(14(12)16)17-6-10-18(11-7-17)8-1-2-9-18;/h3-5H,1-2,6-11H2;1H/q+1;/p-1 | | InChIKey | SEDIOOIGAOGDMF-UHFFFAOYSA-M | | SMILES | ClC1C(=CC=CC=1N1CC[N+]2(CCCC2)CC1)Cl.[Br-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane BroMide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane Bromide is an intermediate used in the preparation of Aripiprazole (A771000), a selective dopamine D2-receptor antagonist with dopamine autoreceptor agonist activity. Antipsychotic. Aripiprazole Impurity 12 |
| | 8-(2,3-Dichlorophenyl)-8-aza-5-azoniaspiro[4.5]decane BroMide Preparation Products And Raw materials |
|