| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol Basic information |
| Product Name: | 1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol | | Synonyms: | 1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol;1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol 95%;1,6-Diazaspiro[3.3]heptan-3-ol, 6-[(4-methylphenyl)sulfonyl]-1-(phenylmethyl)-;1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol | | CAS: | 1349199-70-7 | | MF: | C19H22N2O3S | | MW: | 358.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1349199-70-7.mol | ![1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol Structure](CAS/GIF/1349199-70-7.gif) |
| | 1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | InChI | 1S/C19H22N2O3S/c1-15-7-9-17(10-8-15)25(23,24)21-13-19(14-21)18(22)12-20(19)11-16-5-3-2-4-6-16/h2-10,18,22H,11-14H2,1H3 | | InChIKey | LGWSZRHTXSQOOE-UHFFFAOYSA-N | | SMILES | OC1CN(CC2=CC=CC=C2)C13CN(S(C4=CC=C(C)C=C4)(=O)=O)C3 |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 13 - Non Combustible Solids |
| | 1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol Usage And Synthesis |
| Uses | Spirocyclic building block is part of a series of advanced angular[3.3]heptanes developed by Carreira and coworkers. |
| | 1-Benzyl-6-tosyl-1,6-diazaspiro[3.3]heptan-3-ol Preparation Products And Raw materials |
|