- Tianeptine Ethyl Ester
-
- $10.00
-
2026-09-11
- CAS:66981-77-9
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 10 ton
|
| | Tianeptine Ethyl Ester Basic information |
| Product Name: | Tianeptine Ethyl Ester | | Synonyms: | Tianeptine Ethyl Ester;FEFUFMZSNHPQDX-UHFFFAOYSA-N;Tianeptine-001;Tianeptine EP Impurity B;Tianeptine Impurity 2(Tianeptine EP Impurity B);7-[(3-Chloro-6,11-dihydro-6-methyl-5,5-dioxidodibenzo[c,f][1,2]thiazepin-11-yl)amino] heptanoic acid ethyl ester sulfate;Tianeptine Impurity 1;ethyl 7-[(3-chloro-6-methyl-5,5-dioxo-11~{H}-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate | | CAS: | 66981-77-9 | | MF: | C23H29ClN2O4S | | MW: | 465.01 | | EINECS: | 606-227-7 | | Product Categories: | | | Mol File: | 66981-77-9.mol |  |
| | Tianeptine Ethyl Ester Chemical Properties |
| Boiling point | 573.3±60.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 7.44±0.20(Predicted) | | color | Colourless | | InChIKey | FEFUFMZSNHPQDX-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCCCCCNC1C2=CC=C(Cl)C=C2S(=O)(=O)N(C)C2=CC=CC=C21 |
| | Tianeptine Ethyl Ester Usage And Synthesis |
| Uses | Tianeptine Ethyl Ester is an impurity of Tianeptine (T436800),an tricyclic compound with psychostimulant, anti-ulcer and anti-emetic properties. |
| | Tianeptine Ethyl Ester Preparation Products And Raw materials |
|