Sorafenib related coMpound 8 manufacturers
|
| | Sorafenib related coMpound 8 Basic information |
| Product Name: | Sorafenib related coMpound 8 | | Synonyms: | Sorafenib related coMpound 8;Sorafenib 2-Chloro Analog;Sorafenib Related Compound 20;Sorafenib impurity 4/4-Deschloro-2-chloro-Sorafenib/4-(4-(3-(2-chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-N-methylpicolinamide;4-(4-(3-(2-chloro-3-(trifluoromethyl);Sorafenib impurity V;2-Pyridinecarboxamide, 4-[4-[[[[2-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-;4-[4-({[2-chloro-3-(trifluoromethyl)phenyl]carbamo
yl}amino)phenoxy]-N-methylpyridine-2-carboxamide | | CAS: | 1431697-81-2 | | MF: | C21H16ClF3N4O3 | | MW: | 464.82 | | EINECS: | | | Product Categories: | | | Mol File: | 1431697-81-2.mol |  |
| | Sorafenib related coMpound 8 Chemical Properties |
| Boiling point | 520.0±50.0 °C(Predicted) | | density | 1.454±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 12.84±0.70(Predicted) | | form | Solid | | color | White to Pale Yellow | | Major Application | pharmaceutical | | InChI | 1S/C21H16ClF3N4O3/c1-26-19(30)17-11-14(9-10-27-17)32-13-7-5-12(6-8-13)28-20(31)29-16-4-2-3-15(18(16)22)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) | | InChIKey | JWAKXXCHFJSKRN-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1c(c(ccc1)NC(=O)Nc2ccc(cc2)Oc3cc(ncc3)C(=O)NC)Cl |
| WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Lact.
Repr. 1B
STOT RE 1 |
| | Sorafenib related coMpound 8 Usage And Synthesis |
| Uses | 4-Deschloro-2-chloro-Sorafenib is a derivative of Sorafenib (S676850), a multiple kinase inhibitor targeting both RAF kinase and receptor tyrosine kinases that promote angiogensis. Antineoplastic. |
| | Sorafenib related coMpound 8 Preparation Products And Raw materials |
|