|
|
| | 3,5-Dichloro-6-ethylpyrazinecarboxamide Basic information |
| Product Name: | 3,5-Dichloro-6-ethylpyrazinecarboxamide | | Synonyms: | 3,5-Dichloro-6-ethylpyrazinecarboxamide;3,5-Dichloro-6-ethyl-pyrazine-2-carboxylic acid amide;3,5-dichloro-6-ethyl-2-Pyrazinecarboxamide;2-Pyrazinecarboxamide, 3,5-dichloro-6-ethyl-;3,5-Dichloro-6-ethylpyrazine-2-carboxaMide | | CAS: | 313340-08-8 | | MF: | C7H7Cl2N3O | | MW: | 220.06 | | EINECS: | | | Product Categories: | API | | Mol File: | 313340-08-8.mol |  |
| | 3,5-Dichloro-6-ethylpyrazinecarboxamide Chemical Properties |
| Boiling point | 271.3±40.0 °C(Predicted) | | density | 1.454±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 13.10±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H7Cl2N3O/c1-2-3-5(8)12-6(9)4(11-3)7(10)13/h2H2,1H3,(H2,10,13) | | InChIKey | KMIXLCQPYRNBEH-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)=NC(CC)=C(Cl)N=C1Cl |
| | 3,5-Dichloro-6-ethylpyrazinecarboxamide Usage And Synthesis |
| Uses | 3,5-Dichloro-6-ethyl-2-pyrazinecarboxamide acts as a reagent in the preparation of nitrogen-containing heterocyclic derivatives as remedies for complications of diabetes. |
| | 3,5-Dichloro-6-ethylpyrazinecarboxamide Preparation Products And Raw materials |
|