| Company Name: |
Creative Enzymes |
| Tel: |
1-516-855-7709 |
| Email: |
info@creative-enzymes.com |
|
| | 1,2-dioctanoyl-sn-glycero-3-phospho-(1'-rac-glycerol) (sodiuM salt) Basic information |
| | 1,2-dioctanoyl-sn-glycero-3-phospho-(1'-rac-glycerol) (sodiuM salt) Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChIKey | RMRPSQXPMWXLAU-TVEITMRYSA-M | | SMILES | [H][C@@](COP([O-])(OCC(O)CO)=O)(OC(CCCCCCC)=O)COC(CCCCCCC)=O.[Na+] |
| Storage Class | 11 - Combustible Solids |
| | 1,2-dioctanoyl-sn-glycero-3-phospho-(1'-rac-glycerol) (sodiuM salt) Usage And Synthesis |
| Uses | Glycerophospholipids act as regulators of various enzyme activities, and can be used as biological markers to indicate pathological states. | | Biological Activity | Phosphatidylglycerol (PG) can serve as a specific ligand for 4E10 (neutralizing antibody) in the crystal structures. 08:0 PG serves as cryoprotectant in crystallization studies. |
| | 1,2-dioctanoyl-sn-glycero-3-phospho-(1'-rac-glycerol) (sodiuM salt) Preparation Products And Raw materials |
|