| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 1,2-diphytanoyl-sn-glycero-3-phosphate (sodiuM salt) Basic information |
| | 1,2-diphytanoyl-sn-glycero-3-phosphate (sodiuM salt) Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChIKey | NEIUEUKNXXGRQS-BPBIDKDCSA-M | | SMILES | [H][C@@](COP([O-])(O)=O)(OC(CC(C)CCCC(C)CCCC(C)CCCC(C)C)=O)COC(CC(C)CCCC(C)CCCC(C)CCCC(C)C)=O.[Na+] |
| Storage Class | 11 - Combustible Solids |
| | 1,2-diphytanoyl-sn-glycero-3-phosphate (sodiuM salt) Usage And Synthesis |
| Uses | 4ME 16:0 PA (1,2-diphytanoyl-sn-glycero-3-phosphate (sodium salt)) may be used:
- as a phospholipid standard to quantify phosphatidic acid in plant samples using mass spectrometry analysis
- as a component in symmetric/ asymmetric lipid bilayer for biophysical studies
- to prepare lipid bilayers
| | Biological Activity | Phosphatidic acid (PA) may regulate phagocyte respiratory burst. |
| | 1,2-diphytanoyl-sn-glycero-3-phosphate (sodiuM salt) Preparation Products And Raw materials |
|