- Venetoclax Impurity 8
-
- $0.00 / 10mg
-
2025-09-25
- CAS:1228837-05-5
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
- Venetoclax Impurity 8
-
- $0.00 / 10mg
-
2025-09-25
- CAS:1228837-05-5
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
|
| | 4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde Basic information |
| Product Name: | 4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde | | Synonyms: | 4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde;2-(4-chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carboxaldehyde;2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde;2-(4-Chlorophenyl)-4,4-dimethylcyclohex-1-enecarboxaldehyde;2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-enecarbaldehyde;1-Cyclohexene-1-carboxaldehyde, 2-(4-chlorophenyl)-4,4-dimethyl-;124257;2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-ene-1-carbaldehyde | | CAS: | 1228837-05-5 | | MF: | C15H17ClO | | MW: | 248.75 | | EINECS: | | | Product Categories: | | | Mol File: | 1228837-05-5.mol | ![4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde Structure](CAS/20150408/GIF/1228837-05-5.gif) |
| | 4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde Chemical Properties |
| Melting point | 35-36°C | | Boiling point | 347.9±42.0 °C(Predicted) | | density | 1.147±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C15H17ClO/c1-15(2)8-7-12(10-17)14(9-15)11-3-5-13(16)6-4-11/h3-6,10H,7-9H2,1-2H3 | | InChIKey | OOUSVDAPSBFSBR-UHFFFAOYSA-N | | SMILES | C1(C=O)CCC(C)(C)CC=1C1=CC=C(Cl)C=C1 |
| | 4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde Usage And Synthesis |
| Uses | 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carboxaldehyde is an intermediate in various reactions. For example, its an intermediate in preparation of N-?(phenylsulfonyl)?benzamides and N-?(3-?pyridylsulfonyl)?benzamides as apoptosis-?inducing agents for the treatment of cancer and immune diseases and autoimmune diseases. |
| | 4'-chloro-5,5-diMethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-carbaldehyde Preparation Products And Raw materials |
|