| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 18-Hydroxycorticosterone-[D4] Basic information |
| Product Name: | 18-Hydroxycorticosterone-[D4] | | Synonyms: | 18-Hydroxycorticosterone-[D4];18-Hydroxycorticosterone-[D4] (CertiMass solution);18-HYDROXYCORTICOSTERONE (9,11,12,12-D4,98%) CHEM. PURITY 95%;18-HYDROXYCORTICOSTERONE (9,11,12,12-D4, 98%) 100 UG/ML IN ACETONITRILE;Hydroxycorticosterone-[d4];18-Hydroxycorticosterone-9,11,12,12-d4 >=98 atom % D, >=95% (CP);18-Hydroxycorticosterone-[d4](Solution);2H4]-18-Hydroxycorticosterone | | CAS: | 1257742-38-3 | | MF: | C21H30O5 | | MW: | 362.47 | | EINECS: | | | Product Categories: | | | Mol File: | 1257742-38-3.mol | ![18-Hydroxycorticosterone-[D4] Structure](CAS/20180629/GIF/1257742-38-3.gif) |
| | 18-Hydroxycorticosterone-[D4] Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChIKey | HFSXHZZDNDGLQN-NREATFFYSA-N | | SMILES | [2H]C1([2H])[C@]([2H])(O)[C@@]2([2H])[C@@H](CCC3=CC(=O)CC[C@]23C)[C@@H]4CC[C@H](C(=O)CO)[C@@]14CO | | CAS Number Unlabeled | 561-65-9 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 18-Hydroxycorticosterone-[D4] Usage And Synthesis |
| Uses | 18-Hydroxycorticosterone-d4 is the deuterium labeled 18-Hydroxycorticosterone. 18-Hydroxycorticosterone is a corticosteroid and a derivative of corticosterone, which can lead to serious electrolyte imbalances. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | 18-Hydroxycorticosterone-[D4] Preparation Products And Raw materials |
|