| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Bimane amine Basic information |
| Product Name: | Bimane amine | | Synonyms: | Aminobimane;3-Aminomethyl-2,5,6-trimethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione;Bimane amine BioReagent, suitable for fluorescence, >=98.0% (HPCE);1H,7H-Pyrazolo[1,2-a]pyrazole-1,7-dione, 3-(aminomethyl)-2,5,6-trimethyl-;Bimane amine | | CAS: | 76421-90-4 | | MF: | C10H13N3O2 | | MW: | 207.23 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Bimane amine Chemical Properties |
| Boiling point | 321.2±44.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | solid | | pka | 10.36±0.29(Predicted) | | BRN | 4186574 | | InChI | 1S/C10H13N3O2/c1-5-7(3)12-8(4-11)6(2)10(15)13(12)9(5)14/h4,11H2,1-3H3 | | InChIKey | WLADQYKRYSPMME-UHFFFAOYSA-N | | SMILES | CC1=C(C)C(=O)N2N1C(CN)=C(C)C2=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Bimane amine Usage And Synthesis |
| Uses | Bimane amine (Aminobimane) may be useful as a fluorescent probe for molecules that react with primary amines. |
| | Bimane amine Preparation Products And Raw materials |
|