| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Fluconazole Impurity 1 Basic information |
| Product Name: | Fluconazole Impurity 1 | | Synonyms: | 2-(2,4-Difluorophenyl)-1,2,3-propanetriol;2-(2,4-Difluorophenyl)propane-1,2,3;1,2,3-Propanetriol, 2-(2,4-difluorophenyl)-;Fluconazole Impurity 35;Fluconazole Impurity 1;2-(2,4-Difluorophenyl)propane-1,2,3-triol (Efinaconazole?Impurity);Abscisic Acid Impurity 12 | | CAS: | 173837-65-5 | | MF: | C9H10F2O3 | | MW: | 204.17 | | EINECS: | | | Product Categories: | | | Mol File: | 173837-65-5.mol |  |
| | Fluconazole Impurity 1 Chemical Properties |
| Melting point | 63 - 65°C | | Boiling point | 390.8±37.0 °C(Predicted) | | density | 1.452±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.33±0.29(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChI | 1S/C9H10F2O3/c10-6-1-2-7(8(11)3-6)9(14,4-12)5-13/h1-3,12-14H,4-5H2 | | InChIKey | ZHVKNFSTIAMHSM-UHFFFAOYSA-N | | SMILES | OCC(C1=CC=C(F)C=C1F)(O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Fluconazole Impurity 1 Usage And Synthesis |
| Uses | 2-(2,4-Difluorophenyl)-1,2,3-propanetriol is used as a reagent in the synthesis of glycerol derivatives as intermediates for antifungal phenyltriazolylpropanediol derivatives. Also an impurity of the antifungal agent Fluconazole (F421000). |
| | Fluconazole Impurity 1 Preparation Products And Raw materials |
|