| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | hydrazinecarbothioic acid O-methyl ester Basic information |
| Product Name: | hydrazinecarbothioic acid O-methyl ester | | Synonyms: | methyl imidothiocarbamate;hydrazinecarbothioic acid O-methyl ester;hydrazinomethanethioic acid O-methyl ester;O-methyl hydrazinomethanethioate;O-methyl hydrazinylmethanethioate;Thiocarbazic acid O-methyl ester;O-methyl hydrazinecarbothioate | | CAS: | 19692-07-0 | | MF: | C2H6N2OS | | MW: | 106.15 | | EINECS: | | | Product Categories: | | | Mol File: | 19692-07-0.mol |  |
| | hydrazinecarbothioic acid O-methyl ester Chemical Properties |
| Melting point | 72-74 °C | | Boiling point | 142.0±23.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO, Methanol (Slightly) | | form | Solid | | pka | 9.93±0.70(Predicted) | | color | Light Orange to Light Red | | Stability: | Stench | | InChI | InChI=1S/C2H6N2OS/c1-5-2(6)4-3/h3H2,1H3,(H,4,6) | | InChIKey | LNWHCOPMPXKPNZ-UHFFFAOYSA-N | | SMILES | N(C(=S)OC)N |
| | hydrazinecarbothioic acid O-methyl ester Usage And Synthesis |
| Uses | Hydrazinecarbothioic Acid O-methyl Ester acts as a reagent for the synthesis of methidation, an insecticide. |
| | hydrazinecarbothioic acid O-methyl ester Preparation Products And Raw materials |
|