|
|
| | 2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid Basic information |
| Product Name: | 2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid | | Synonyms: | Benzo[b]thiophene-3-carboxylic acid, 2-amino-4,5,6,7-tetrahydro-;2-AMINO-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHENE-3-CARBOXYLIC ACID;AKOS MSC-0448;ZERENEX E/5111071;RARECHEM AL BO 1663;2-Amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid;2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid | | CAS: | 5936-58-3 | | MF: | C9H11NO2S | | MW: | 197.25 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid Structure](StructureFile/ChemBookStructure3/GIF/CB0274481.gif) |
| | 2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid Chemical Properties |
| Melting point | 155-156℃ | | Boiling point | 418.5±45.0 °C(Predicted) | | density | 1.403 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 5.67±0.20(Predicted) | | Appearance | Yellow to brown Solid | | InChI | 1S/C9H11NO2S/c10-8-7(9(11)12)5-3-1-2-4-6(5)13-8/h1-4,10H2,(H,11,12) | | InChIKey | WYOLDVOOOYZSJM-UHFFFAOYSA-N | | SMILES | NC(S1)=C(C(O)=O)C2=C1CCCC2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid Usage And Synthesis |
| | 2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid Preparation Products And Raw materials |
| Preparation Products | 5,6,7,8-tetrahydro-2-methyl-4H-[1]benzothieno[2,3-d][1,3]oxazin-4-one-->3-(4-chlorophenyl)-2-sulfanyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one-->3-Allyl-2-mercapto-5,6,7,8-tetrahydro-3H-benzo[4,5]thieno[2,3-d]pyrimidin-4-one |
|