|
|
| | tert-Butyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate Basic information | | Application |
| | tert-Butyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate Chemical Properties |
| Boiling point | 428.9±45.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | pka | 12.27±0.20(Predicted) | | InChI | InChI=1S/C10H16N2O4/c1-9(2,3)16-8(14)12-5-10(6-12)4-11-7(13)15-10/h4-6H2,1-3H3,(H,11,13) | | InChIKey | MDUVXSNNJOOYHF-UHFFFAOYSA-N | | SMILES | C1C2(CNC(=O)O2)CN1C(OC(C)(C)C)=O |
| | tert-Butyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate Usage And Synthesis |
| Application | Tert-butyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate can be used as a pharmaceutical intermediate and has wide applications in medicinal chemistry and organic synthesis. |
| | tert-Butyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate Preparation Products And Raw materials |
|