| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl (hydroxyimino)cyanoacetate potassium salt Basic information |
| Product Name: | Ethyl (hydroxyimino)cyanoacetate potassium salt | | Synonyms: | 2-Cyano-2-(hydroxyimino)acetic acid ethyl ester, potassium salt;Ethyl (hydroxyimino)cyanoacetate potassium salt;Cyano(hydroxyimino)acetic acid ethyl ester potassium salt;2-Cyano-2-(hydroxyimino)acetic acid ethyl ester potassium salt (1:1);Ethyl (hydroxyimino)cyanoacetate potassium;K-Oxyma≥ 99% (HPLC);K-Oxyma Pure Novabiochem;K-Oxyma Pure | | CAS: | 158014-03-0 | | MF: | C5H6N2O3.K | | MW: | 181.21 | | EINECS: | | | Product Categories: | | | Mol File: | 158014-03-0.mol |  |
| | Ethyl (hydroxyimino)cyanoacetate potassium salt Chemical Properties |
| Melting point | 145-155°C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Sparingly) | | form | Solid | | color | Dark Yellow | | Major Application | peptide synthesis | | InChI | InChI=1S/C5H6N2O3.K/c1-2-10-5(8)4(3-6)7-9;/h9H,2H2,1H3;/q;+1/p-1/b7-4+; | | InChIKey | ZFBMUWGNRJITLS-KQGICBIGSA-M | | SMILES | [K+].C(OCC)(=O)/C(=N/[O-])/C#N |
| Hazard Codes | T | | Risk Statements | 20/21-25-43 | | Safety Statements | 36/37-45 | | RIDADR | UN 3439 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2928 00 90 | | Storage Class | 11 - Combustible Solids |
| | Ethyl (hydroxyimino)cyanoacetate potassium salt Usage And Synthesis |
| Chemical Properties | Bright yellow powder | | Uses | Useful in peptide coupling on mild acid-labile resins with minimal to no cleavage of the peptide from the resin due to its more alkaline character. This can be used to replace the explosive HOBt and HOAt. | | Uses | - Non-explosive replacement for HOBt and HOAt with at least comparable performance to HOAt
- Outperforms HOAt in sterically demanding peptide bond formations
- Compatible with carbodiimide-mediated; solution and solid phase peptide coupling;
- Less epimerization than HOBt in fragment condensation reactions
- K-salt especially useful in peptide coupling on mild acid-labile resins such as 2-chlorotrityl; leading to minimal to no cleavage of the peptide from the resin due to its more alkaline character
- K-salt has a higher melting point than OxymaPure
| | Uses | Ethyl (hydroxyimino)cyanoacetate potassium salt is a Non-explosive replacement for HOBt and HOAt with at least comparable performance to HOAt Outperforms HOAt in sterically demanding peptide bond formations Compatible with carbodiimide-mediated; solution and solid phase peptide coupling; Less epimerization than HOBt in fragment condensation reactions K-salt especially useful in peptide coupling on mild acid-labile resins such as 2-chlorotrityl; leading to minimal to no cleavage of the peptide from the resin due to its more alkaline character K-salt has a higher melting point than OxymaPure. | | reaction suitability | reaction type: Coupling Reactions |
| | Ethyl (hydroxyimino)cyanoacetate potassium salt Preparation Products And Raw materials |
|