| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Poly(ethylene glycol) diacrylamide
Basic information |
| Product Name: | Poly(ethylene glycol) diacrylamide
| | Synonyms: | Poly(ethylene glycol) diacrylamide
;CAS_160556-48-9;Poly(ethylene glycol) diacrylamide average Mn 3,700, contains <=1,500 ppm HQ as inhibitor;Acrylamide - polyethylene glycol - acrylamide;Poly(oxy-1,2-ethanediyl), α-[2-[(1-oxo-2-propen-1-yl)amino]ethyl]-ω-[2-[(1-oxo-2-propen-1-yl)amino]ethoxy]-;Acrylamide-PEG-Acrylamide , Mn:10000 | | CAS: | 160556-48-9 | | MF: | (C2H4O)nC10H16N2O3 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 160556-48-9.mol |  |
| | Poly(ethylene glycol) diacrylamide
Chemical Properties |
| Fp | >110℃ | | storage temp. | -20°C | | solubility | deionized water: 20 wt. % at 23 °C | | form | solid | | color | white to off-white | | Water Solubility | deionized water: 20wt. % at23°C | | α-end | acrylamide | | Ω-end | acrylamide | | InChI | InChI=1S/C12H20N2O4/c1-3-11(15)13-5-7-17-9-10-18-8-6-14-12(16)4-2/h3-4H,1-2,5-10H2,(H,13,15)(H,14,16) | | InChIKey | UMVFOWMSJBWRMN-UHFFFAOYSA-N | | SMILES | C(=O)(C=C)NCCO{-}CC{+n}OCCNC(=O)C=C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Poly(ethylene glycol) diacrylamide
Usage And Synthesis |
| Uses | PEG diacrylamide is a biocompatible, hydrophilic polymer commonly used to form crosslinked polymer networks and PEG hydrogels. Crosslinked networks can be formed via radical initiator induced polymerization and photopolymerization. Due to its stable amide bond, PEG diacrylamide can be used to prepare hydrogels suitable for long-term studies and eliminate non-specific hydrogel degradation. The acrylamide functional groups can also be reacted with thiol-containing peptide crosslinkers to create enzymatically-sensitive crosslinked networks. PEG diacrylamide has numerous applications in tissue engineering, 3D printing, and drug delivery.
|
| | Poly(ethylene glycol) diacrylamide
Preparation Products And Raw materials |
|