| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
ATRP initiator manufacturers
|
| | ATRP initiator Basic information |
| Product Name: | ATRP initiator | | Synonyms: | 2-Bromoisobutyric anhydride;Propanoic acid, 2-bromo-2-methyl-, 1,1'-anhydride;2-Bromoisobutyric anhydride 95%;2-Bromo-2-methylpropanoic anhydride | | CAS: | 42069-15-8 | | MF: | C8H12Br2O3 | | MW: | 315.99 | | EINECS: | | | Product Categories: | | | Mol File: | 42069-15-8.mol |  |
| | ATRP initiator Chemical Properties |
| Melting point | 56-60°C | | form | powder | | InChI | 1S/C8H12Br2O3/c1-7(2,9)5(11)13-6(12)8(3,4)10/h1-4H3 | | InChIKey | CHYAZMNKLHWVBP-UHFFFAOYSA-N | | SMILES | CC(C)(Br)C(=O)OC(=O)C(C)(C)Br |
| Hazard Codes | C,Xn | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-39 | | RIDADR | UN 3265 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Dam. 1
Skin Corr. 1B |
| | ATRP initiator Usage And Synthesis |
| Uses | Highly effective difunctional initiator for atom transfer radical polymerization (ATRP). |
| | ATRP initiator Preparation Products And Raw materials |
|