|
|
| | Poly(dicyclopentadiene-co-p-cresol) Basic information |
| | Poly(dicyclopentadiene-co-p-cresol) Chemical Properties |
| Melting point | 105°C | | Boiling point | 320℃[at 101 325 Pa] | | density | 1.1 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C, stored under nitrogen | | form | solid | | Appearance | White to off-white Solid | | Water Solubility | 10μg/L at 20℃ | | InChI | InChI=1S/C10H12.C7H8O.C4H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-6-2-4-7(8)5-3-6;1-4(2)3/h1-2,4-5,7-10H,3,6H2;2-5,8H,1H3;1H2,2-3H3 | | InChIKey | UQQYHXZNSYZMEN-UHFFFAOYSA-N | | SMILES | C12CC=CC1C1C=CC2C1.CC1C=CC(O)=CC=1.C(=C)(C)C | | LogP | 7.93 at 25℃ | | CAS DataBase Reference | 68610-51-5(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-methyl-, reaction products with dicyclopentadiene and isobutylene (68610-51-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-53 | | Safety Statements | 26-36 | | WGK Germany | 1 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | Poly(dicyclopentadiene-co-p-cresol) Usage And Synthesis |
| Uses | Poly(dicyclopentadiene-co-p-cresol) may be used as an antioxidant. | | General Description | Poly(dicyclopentadiene-co-p-cresol) is a sterically hindered phenol. | | Flammability and Explosibility | Non flammable |
| | Poly(dicyclopentadiene-co-p-cresol) Preparation Products And Raw materials |
|