|
|
| | 5-Methoxy-2-methyl-1H-indole-3-carbaldehyde Basic information |
| | 5-Methoxy-2-methyl-1H-indole-3-carbaldehyde Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C11H11NO2/c1-7-10(6-13)9-5-8(14-2)3-4-11(9)12-7/h3-6,12H,1-2H3 | | InChIKey | KDXXXECBTWLZSQ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C(C=O)=C1C |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 5-Methoxy-2-methyl-1H-indole-3-carbaldehyde Usage And Synthesis |
| Uses | 5-METHOXY-2-METHYL-1H-INDOLE-3-CARBALDEHYDE is an intermediate in the preparation of many pharmaceutically active indole derivatives. It is used for the synthesis of 2-Methylserotonin (M326855), which is a derivative of the neurotransmitter serotonin (S274980). | | Uses | 5-Methoxy-2-methylindole-3-carboxaldehyde, is an intermediate in the preparation of many pharmaceutically active indole derivatives. It is used for the synthesis of 2-Methylserotonin (M326855), which is a derivative of the neurotransmitter serotonin (S274980). |
| | 5-Methoxy-2-methyl-1H-indole-3-carbaldehyde Preparation Products And Raw materials |
|