| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Methylflavone-8-carboxylic acid Basic information |
| | 3-Methylflavone-8-carboxylic acid Chemical Properties |
| Melting point | 234-236°C | | Boiling point | 485.1±45.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | Store below +30°C. | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.85±0.40(Predicted) | | color | White | | BRN | 1433509 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C17H12O4/c1-10-14(18)12-8-5-9-13(17(19)20)16(12)21-15(10)11-6-3-2-4-7-11/h2-9H,1H3,(H,19,20) | | InChIKey | KMMBBZOSQNLLMN-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)OC2=C(C(O)=O)C=CC=C2C(=O)C=1C | | CAS DataBase Reference | 3468-01-7(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HS Code | 2932996560 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Methylflavone-8-carboxylic acid Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | The main active metabolite of Flavoxate hydrochloride (FX) in human. | | Definition | ChEBI: A member of the class of flavones that is flavone substituted at position 3 by a methyl group and at position 8 by a carboxylic acid group. |
| | 3-Methylflavone-8-carboxylic acid Preparation Products And Raw materials |
|