|
|
| | B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE Basic information |
| Product Name: | B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE | | Synonyms: | R-ALPINE-BORANE(R);B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE;(R)-B-isopinocampheyl-9-borabicyclo[3.3.1]nonane;R-2,7,7-trimethylnorpinanborabicyclo(3.3.1)nonane;R-alpine-borane (0.5M soln. in thf);R-Alpine-Borane? (R)-2,6,6-trimethyl-4-(9-borabicyclo[3.3.1]nonan-9-yl)bicyclo[3.1.1]heptane;R-ALPINE-BORANE;R-ALPINE-BORANE 97% | | CAS: | 73624-47-2 | | MF: | C18H31B | | MW: | 258.25 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 73624-47-2.mol | ![B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE Structure](CAS/GIF/73624-47-2.gif) |
| | B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE Chemical Properties |
| alpha | -3 º (NEAT) | | Boiling point | >55 °C(lit.) | | density | 0.896 g/mL at 25 °C | | Fp | 1 °F | | form | liquid | | Optical Rotation | [α]21/D -22°, c = 12 in THF | | InChI | 1S/C18H31B/c1-12-16-10-13(18(16,2)3)11-17(12)19-14-6-4-7-15(19)9-5-8-14/h12-17H,4-11H2,1-3H3/t12-,13+,14-,15+,16-,17-/m1/s1 | | InChIKey | VCDGSBJCRYTLNU-PHPOFCCKSA-N | | SMILES | C[C@H]1[C@@H](C[C@@H]2C[C@H]1C2(C)C)B3[C@@H]4CCC[C@H]3CCC4 |
| | B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE Usage And Synthesis |
| Uses | R-Alpine-Borane? solution may be used to prepare:
- (R)-5-(Benzyloxy)pent-3-y-2-ol, an intermediate for the stereoselective total synthesis of (-)-stagonolide D.
- (R)-1-(p-Tolyl)-1-pentyn-3-ol, an intermediate for the enatioselective synthesis of (R)-incrustoporin.
- N-(tert-Butyloxycarbonyl)-(4S)-[4-2H]-1-L-homoserine tert-butyl ester, an intermediate for synthesizing (4S)-[4-2H]-L-homoserine.
| | General Description | R-Alpine-Borane? is a chiral reducing agent, synthesized from (+)-α-pinene via hydroboration. |
| | B-ISOPINOCAMPHEYL-9-BORABICYCLO[3.3.1]NONANE Preparation Products And Raw materials |
|