|
|
| | tert-butyl 3-(bromomethyl)-3-fluoroazetidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 3-(bromomethyl)-3-fluoroazetidine-1-carboxylate | | Synonyms: | tert-butyl 3-(bromomethyl)-3-fluoroazetidine-1-carboxylate;1-Boc-3-bromomethyl-3-fluoroazetidine;1-Azetidinecarboxylic acid, 3-(bromomethyl)-3-fluoro-, 1,1-dimethylethyl ester;3-Bromomethyl-3-fluoro-azetidine-1-carboxylic acid tert-butyl ester;1-Boc-3-bromomethyl-3-fluoroazetidine - [B14924] | | CAS: | 1374658-83-9 | | MF: | C9H15BrFNO2 | | MW: | 268.12 | | EINECS: | | | Product Categories: | | | Mol File: | 1374658-83-9.mol |  |
| | tert-butyl 3-(bromomethyl)-3-fluoroazetidine-1-carboxylate Chemical Properties |
| Boiling point | 284.3±25.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | -5.19±0.40(Predicted) | | Appearance | white to off-white solid | | InChI | InChI=1S/C9H15BrFNO2/c1-8(2,3)14-7(13)12-5-9(11,4-10)6-12/h4-6H2,1-3H3 | | InChIKey | XBEPSYXHSSWJFY-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(CBr)(F)C1 |
| | tert-butyl 3-(bromomethyl)-3-fluoroazetidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 3-(bromomethyl)-3-fluoroazetidine-1-carboxylate Preparation Products And Raw materials |
|