|
|
| | N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine Basic information |
| Product Name: | N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine | | Synonyms: | N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine;N-([1,1-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine(WXC04064);2-(3-Biphenylyl)amino-9,9-dimethylfluorene;9H-Fluoren-2-amine, N-[1,1'-biphenyl]-3-yl-9,9-dimethyl-;9,9-Dimethyl-N-(3-phenylphenyl)fluoren-2-amine;N-([1,1-dibiphenyl]-3-yl)-9,9-dimethyl-9H-fluorene-2-amine | | CAS: | 1372778-66-9 | | MF: | C27H23N | | MW: | 361.48 | | EINECS: | | | Product Categories: | | | Mol File: | 1372778-66-9.mol | ![N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine Structure](CAS/20180629/GIF/1372778-66-9.gif) |
| | N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine Chemical Properties |
| Melting point | 135.0
~139.0
°C | | Boiling point | 544.9±39.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 0.79±0.40(Predicted) | | form | powder to crystal | | color | White to Green to Brown | | InChI | InChI=1S/C27H23N/c1-27(2)25-14-7-6-13-23(25)24-16-15-22(18-26(24)27)28-21-12-8-11-20(17-21)19-9-4-3-5-10-19/h3-18,28H,1-2H3 | | InChIKey | SLMLVHPSGBYQPA-UHFFFAOYSA-N | | SMILES | C1(C)(C)C2=C(C=CC=C2)C2=C1C=C(NC1C=CC=C(C3=CC=CC=C3)C=1)C=C2 | | CAS DataBase Reference | 1372778-66-9 |
| | N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine Usage And Synthesis |
| | N-([1,1'-biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-2-amine Preparation Products And Raw materials |
|