| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
10β,17β-dihydroxyestra-1,4-dien-3-one manufacturers
|
| | 10β,17β-dihydroxyestra-1,4-dien-3-one Basic information |
| Product Name: | 10β,17β-dihydroxyestra-1,4-dien-3-one | | Synonyms: | 10β,17β-dihydroxyestra-1,4-dien-3-one;Estra-1,4-dien-3-one, 10,17-dihydroxy-, (17β)-;10,17β-Dihydroxy-estra-1,4-dien-3-one;10β;17β-dihydroxyestra-1;4-dien-3-one;10β,17β dihydroxyestra 1,4 dien 3 one,10β,17βdihydroxyestra1,4dien3one;10b,17b-Dihydroxy-estra-1,4-dien-3-one | | CAS: | 549-02-0 | | MF: | C18H24O3 | | MW: | 288.38 | | EINECS: | | | Product Categories: | | | Mol File: | 549-02-0.mol |  |
| | 10β,17β-dihydroxyestra-1,4-dien-3-one Chemical Properties |
| Melting point | 217-219 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 485.3±45.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 10mg/mL, clear | | form | powder | | pka | 12.35±0.60(Predicted) | | color | white to light brown | | Optical Rotation | [α]/D -20 to -30°, c = 1 in methanol | | InChI | 1S/C18H24O3/c1-17-8-7-15-13(14(17)4-5-16(17)20)3-2-11-10-12(19)6-9-18(11,15)21/h6,9-10,13-16,20-21H,2-5,7-8H2,1H3/t13-,14-,15-,16-,17-,18+/m0/s1 | | InChIKey | UIKDFTLKOKNUJP-UGDFAFBOSA-N | | SMILES | O[C@@]12C(CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4O)=CC(C=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | 10β,17β-dihydroxyestra-1,4-dien-3-one Usage And Synthesis |
| Uses | DHED has been used to induce an increase of estrogen levels in 3K transgenic mice with Parkinson′s disease (PD)-like motor syndrome. | | Biochem/physiol Actions | DHED is a substrate for nicotinamide adenine dinucleotide phosphate (NADPH)-dependent dehydrogenase/reductase. Its expression in the brain is correlated to neuroprotection functionality. | | in vivo | 10β,17β-dihydroxyestra-1,4-dien-3-one (DHED), is an inactive bioprecursor prodrug of 17β-estradiol converting to 17β-estradiol only in the brain. DHED as an E2-bioprecursor may be a viable approach for delivering E2 selectively into the brain for the potential treatment of hot flushes[1]. |
| | 10β,17β-dihydroxyestra-1,4-dien-3-one Preparation Products And Raw materials |
|