| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Chloro-4-iodo-2-methoxypyridine Basic information |
| | 5-Chloro-4-iodo-2-methoxypyridine Chemical Properties |
| Boiling point | 276.2±35.0 °C(Predicted) | | density | 1.915±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | -0.27±0.18(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5ClINO/c1-10-6-2-5(8)4(7)3-9-6/h2-3H,1H3 | | InChIKey | PGCJHZFFXHSLOJ-UHFFFAOYSA-N | | SMILES | C1(OC)=NC=C(Cl)C(I)=C1 |
| | 5-Chloro-4-iodo-2-methoxypyridine Usage And Synthesis |
| | 5-Chloro-4-iodo-2-methoxypyridine Preparation Products And Raw materials |
|