N-Chloroethyl-N-ethylaniline manufacturers
- N-Chloroethyl-N-ethylaniline
-
- $101.00 / 1KG
-
2025-09-25
- CAS:92-49-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | N-Chloroethyl-N-ethylaniline Basic information |
| Product Name: | N-Chloroethyl-N-ethylaniline | | Synonyms: | n-(2-chloroethyl)-n-ethylbenzenamine;n-ethyl-n-(2-chloroethyl)aniline;N-[2-Chloroethyl]-N-ethylbenzeneamine;N-Chlorethyl-N-ethylanilin;N-(2-Chloroethyl)-N-ethylaniline;2-chloroethyl-ethyl-phenyl-amine;N-Chloroethyl-N-ethy;Benzenamine, N-(2-chloroethyl)-N-ethyl- | | CAS: | 92-49-9 | | MF: | C10H14ClN | | MW: | 183.68 | | EINECS: | 202-159-3 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 92-49-9.mol |  |
| | N-Chloroethyl-N-ethylaniline Chemical Properties |
| Melting point | 46°C | | Boiling point | 302.39°C (rough estimate) | | density | 1.0821 (rough estimate) | | refractive index | 1.6100 (estimate) | | pka | 5.52±0.50(Predicted) | | InChI | InChI=1S/C10H14ClN/c1-2-12(9-8-11)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 | | InChIKey | DBDNQNARCHWMSP-UHFFFAOYSA-N | | SMILES | C1(N(CCCl)CC)=CC=CC=C1 | | CAS DataBase Reference | 92-49-9(CAS DataBase Reference) | | EPA Substance Registry System | N-Ethyl-N-(2-chloroethyl)aniline (92-49-9) |
| | N-Chloroethyl-N-ethylaniline Usage And Synthesis |
| Uses | N-Chloroethyl-N-ethylaniline is used as an intermediate in the synthesis of dyes as an aniline organic compound. |
| | N-Chloroethyl-N-ethylaniline Preparation Products And Raw materials |
|