|
|
| | Ethyl N-benzyl-3-oxo-4-piperidine-carboxylate hydrochloride Basic information |
| Product Name: | Ethyl N-benzyl-3-oxo-4-piperidine-carboxylate hydrochloride | | Synonyms: | N-BENZYL-4-CARBETHOXY-3-PIPERIDONE HYDROCHLORIDE;N-BENZYL-3-OXO-4-PIPERIDINECARBOXYLATE HCL;1-BENZYL-4-ETHOXYCARBONYL-3-PIPERIDONE HYDROCHLORIDE;1-Benzyl-4-carboethoxy-3-piperidone hydrochloride~Ethyl 1-benzyl-3-piperidone-4-carboxylate hydrochloride;N-Benzyl-3-oxo-4-piperidinecarboxylate hydrochloride;ethyl N-benzyl-3-oxopiperidine-4-carboxylate hydrochloride;N-Benzyl-3-oxo-piperidine-4-ethylcarboxylate hydrochloride;Ethyl N-benzylpiperid-3-one-4-carboxylate hydrochloride | | CAS: | 52763-21-0 | | MF: | C15H20ClNO3 | | MW: | 297.78 | | EINECS: | 258-162-5 | | Product Categories: | Piperidines, Piperidones, Piperazines | | Mol File: | 52763-21-0.mol |  |
| | Ethyl N-benzyl-3-oxo-4-piperidine-carboxylate hydrochloride Chemical Properties |
| Melting point | 162 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | NH4OH: soluble25mg/mL, clear, yellow ((Methanol)) | | form | Crystalline Powder | | color | White to brown | | BRN | 3749159 | | InChI | InChI=1S/C15H19NO3.ClH/c1-2-19-15(18)13-8-9-16(11-14(13)17)10-12-6-4-3-5-7-12;/h3-7,13H,2,8-11H2,1H3;1H | | InChIKey | UQOMEAWPKSISII-UHFFFAOYSA-N | | SMILES | C1(CCN(CC2C=CC=CC=2)CC1=O)C(=O)OCC.Cl | | CAS DataBase Reference | 52763-21-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Ethyl N-benzyl-3-oxo-4-piperidine-carboxylate hydrochloride Usage And Synthesis |
| Chemical Properties | white to brown crystalline powder | | Uses | Ethyl 1-benzyl-3-oxo-4-piperidinecarboxylate hydrochloride was used in the synthesis of chromeno[3,4-c]pyridin-5-ones. It was used as building block for the syntheses of receptor agonists and antagonists. It was used as starting reagent in the synthesis of 4-amino-5-chloro-2-methoxy-N-[1-[5-(1-methylindol-3-ylcarbonylamino)pentyl]piperidin-4-ylmethyl]benzamide derivative. |
| | Ethyl N-benzyl-3-oxo-4-piperidine-carboxylate hydrochloride Preparation Products And Raw materials |
| Preparation Products | 7-BENZYL-5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDINE-2,4(1H,3H)-DIONE-->7-BENZYL-5,6,7,8-TETRAHYDRO4-CHLORO-PYRIDO[3,4-D]PYRIMIDINE HYDROCHLORIDE-->1-benzyl-4-(hydroxymethyl)piperidin-3-ol-->1-tert-butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate-->1,4(2H)-Pyridinedicarboxylic acid, 3,6-dihydro-, 1-(1,1-dimethylethyl) 4-ethyl ester-->7-BENZYL-4-CHLORO-2-METHYL-5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDINE |
|