|
|
| | 4-(tert-Butyl)benzyl mercaptan Basic information |
| | 4-(tert-Butyl)benzyl mercaptan Chemical Properties |
| Boiling point | 102-103 °C3.1 mm Hg(lit.) | | density | 0.966 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5430(lit.) | | Fp | 162 °F | | pka | 9.83±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C11H16S/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-7,12H,8H2,1-3H3 | | InChIKey | UIYKSYBJKIMANV-UHFFFAOYSA-N | | SMILES | C1(CS)=CC=C(C(C)(C)C)C=C1 | | CAS DataBase Reference | 49543-63-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3334 | | WGK Germany | 3 | | HS Code | 2930909899 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(tert-Butyl)benzyl mercaptan Usage And Synthesis |
| Chemical Properties | Colorless or light yellow liquid | | Uses | 4-tert-Butylbenzyl mercaptan (BBSH) may be used in the preparation of N-Me-aminopyrimidinone derivatives, which are potent state-dependent inhibitor of Nav1.7 (Nav= voltage-gated sodium channel). It may also be used to synthesize organic-soluble, atomically precise array of silver clusters via a novel approach based on the miscibility principle while avoiding the use of phase-transfer agents. | | General Description | 4-tert-Butylbenzyl mercaptan is a benzyl mercaptan derivative that is commonly used as a ligand for synthesizing metal clusters. |
| | 4-(tert-Butyl)benzyl mercaptan Preparation Products And Raw materials |
|