| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,1,2,2-Tetrahydroperfluorododecyl iodide Basic information |
| Product Name: | 1,1,2,2-Tetrahydroperfluorododecyl iodide | | Synonyms: | DAIKIN I-2020;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-12-iodo-dodecan;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-12-iodo-Dodecane;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-HENICOSAFLUORO-12-IODODODECANE;1,1,2,2-Tetrahydroperfluorododecyl iodide;1H,1H,2H,2H-1-IODOPERFLUORODODECANE;1H,1H,2H,2H-PERFLUORODODECYL IODIDE;1-IODO-1H,1H,2H,2H-PERFLUORODODECANE | | CAS: | 2043-54-1 | | MF: | C12H4F21I | | MW: | 674.03 | | EINECS: | 218-054-0 | | Product Categories: | | | Mol File: | 2043-54-1.mol |  |
| | 1,1,2,2-Tetrahydroperfluorododecyl iodide Chemical Properties |
| Melting point | 83-88 °C | | Boiling point | 108 °C | | density | 1.82 | | refractive index | 1.324 | | Fp | 108°C/10mm | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Hexanes (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Specific Gravity | 1.820 | | Sensitive | Light Sensitive | | BRN | 1897869 | | InChI | InChI=1S/C12H4F21I/c13-3(14,1-2-34)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)33/h1-2H2 | | InChIKey | HVWXRMINOYZYCK-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI | | CAS DataBase Reference | 2043-54-1(CAS DataBase Reference) | | EPA Substance Registry System | Dodecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-12-iodo- (2043-54-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29031990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,1,2,2-Tetrahydroperfluorododecyl iodide Usage And Synthesis |
| Uses | 1-(2-Iodoethyl)heneicosafluorodecane is used in preparation method of highly insulated hard nano protecting coating of composite structure. |
| | 1,1,2,2-Tetrahydroperfluorododecyl iodide Preparation Products And Raw materials |
|