|
|
| | trans-4-Methylcyclohexylamine hydrochloride Basic information |
| Product Name: | trans-4-Methylcyclohexylamine hydrochloride | | Synonyms: | TRANS-4-METHYL-CYCLOHEXYLAMINE HCL;TRANS-4-METHYLCYCLOHEXYLAMINE HYDROCHLORIDE;Cyclohexanamine,4-methyl-, hydrochloride, trans- (9CI);trans-4-Methylcyclohexylamine hydrochloride ISO 9001：2015 REACH;tianfu chem trans-4-Methylcyclohexylamine hydrochloride;Glimepiride Impurity 2 HCl;rans-4-Methylcyclohexylaminehydrochloride | | CAS: | 33483-65-7 | | MF: | C7H16ClN | | MW: | 149.66 | | EINECS: | | | Product Categories: | | | Mol File: | 33483-65-7.mol |  |
| | trans-4-Methylcyclohexylamine hydrochloride Chemical Properties |
| Melting point | 260 °C | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C7H15N.ClH/c1-6-2-4-7(8)5-3-6;/h6-7H,2-5,8H2,1H3;1H/t6-,7-; | | InChIKey | GIRKJSRZELQHDX-MEZFUOHNNA-N | | SMILES | N[C@@H]1CC[C@@H](C)CC1.[H]Cl |&1:1,4,r| | | CAS DataBase Reference | 33483-65-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29213000 |
| | trans-4-Methylcyclohexylamine hydrochloride Usage And Synthesis |
| Chemical Properties | Off-white flakes | | Synthesis | trans-4-Methylcyclohexylamine hydrochloride can be produced by the following steps: a) subjecting a Schiff's base to isomerization by treating thereof with a strong base in a solvent being selected from the group consisting of aliphatic ethers, cyclic ethers, dialkylsulfoxides, or dialkyl sulfones to obtain an isomeric compound; b) subjecting the isomeric compound to acid hydrolysis by treating thereof with a mineral acid to obtain a corresponding salt of trans-4-methylcyclohexylamine; c) optionally converting the obtained trans-4-Methylcyclohexylamine hydrochloride. |
| | trans-4-Methylcyclohexylamine hydrochloride Preparation Products And Raw materials |
|