|
|
| | (4-bromophenyl)(indolin-7-yl)methanone Basic information |
| Product Name: | (4-bromophenyl)(indolin-7-yl)methanone | | Synonyms: | Bromfenac Impurity;(4-bromophenyl)(indolin-7-yl)methanone;bromfenac sodiumImpurity f;Bromfenac sodium Impurity 1;(4-bromophenyl)(2,3-dihydro-1H-indol-7-yl)methanone;Methanone, (4-bromophenyl)(2,3-dihydro-1H-indol-7-yl)-;(4-?bromophenyl)?(2,?3-?dihydro-R...;BromfecImpurity7 | | CAS: | 91714-41-9 | | MF: | C15H12BrNO | | MW: | 302.17 | | EINECS: | | | Product Categories: | | | Mol File: | 91714-41-9.mol |  |
| | (4-bromophenyl)(indolin-7-yl)methanone Chemical Properties |
| InChI | InChI=1S/C15H12BrNO/c16-12-6-4-11(5-7-12)15(18)13-3-1-2-10-8-9-17-14(10)13/h1-7,17H,8-9H2 | | InChIKey | LXJUSQJYSGMLNA-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(C1C2=C(C=CC=1)CCN2)=O |
| | (4-bromophenyl)(indolin-7-yl)methanone Usage And Synthesis |
| Uses | (4-Bromophenyl)(indolin-7-yl)methanone is used as a reactant in the preparation of 2-amino-3-benzoylphenylacetic acid and analogs. |
| | (4-bromophenyl)(indolin-7-yl)methanone Preparation Products And Raw materials |
|