|
|
| | tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate Basic information |
| Product Name: | tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate | | Synonyms: | t-Butyl(E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-;tert-Butyl (E)-3,5-d;tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate;Fluvastatin USP RC B;Fluvastatin USP Related Compound;Fluvastatin USP Related Compound B;7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid tert-butyl ester;Fluvastatin Related Compound B (15 mg) ([R*,S*-E]-(+/-)-7-[3-(4-fluorophenyl)-1-methylethyl-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic acid 1,1, dimethylethyl ester) | | CAS: | 129332-29-2 | | MF: | C28H34FNO4 | | MW: | 467.57 | | EINECS: | 603-330-9 | | Product Categories: | Fluvastatine | | Mol File: | 129332-29-2.mol | ![tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate Structure](CAS/GIF/129332-29-2.gif) |
| | tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate Chemical Properties |
| Melting point | 138-143oC | | Boiling point | 642.3±55.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 13.90±0.20(Predicted) | | color | Off-White to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C28H34FNO4/c1-18(2)30-24-9-7-6-8-23(24)27(19-10-12-20(29)13-11-19)25(30)15-14-21(31)16-22(32)17-26(33)34-28(3,4)5/h6-15,18,21-22,31-32H,16-17H2,1-5H3/b15-14+ | | InChIKey | USGKHYXJISAYPE-CCEZHUSRSA-N | | SMILES | Fc1ccc(cc1)c2c3c([n](c2\C=C\C(O)CC(O)CC(=O)OC(C)(C)C)C(C)C)cccc3 | | LogP | 3.3-5.3 at 23℃ |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids |
| | tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate Usage And Synthesis |
| Uses | tert-Butyl Fluvastatin (Fluvastatin USP Related Compound B) is a derivative of Fluvastatin (F601250), a synthetic HMG-CoA reductase inhibitor. Antilipemic. |
| | tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate Preparation Products And Raw materials |
|