|
|
| | 1,2,3,4-Tetrahydro-1-naphthoic acid Basic information |
| Product Name: | 1,2,3,4-Tetrahydro-1-naphthoic acid | | Synonyms: | 1,2,3,4-Tetrahydro-phthalene-1-carboxylic acid;1,2,3,4-TETRAHYDRO-1-NAPHTHOIC ACID;1,2,3,4-TETRAHYDRO-NAPHTHALENE-1-CARBOXYLIC ACID;1,2,3,4-TETRAHEDRO-NAPHTHOIC ACID;1,2,3,4-tetrahydro-naphthoic acid;1,2,3,4-Tetrahydro-1-naphtholic acid;3,4-TETRAHYDRO-NAPHTHALENE-1-CARBOXYLIC ACID;Palonosetron interMediater A | | CAS: | 1914-65-4 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | 641-736-8 | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;Pharmaceutical material and intermeidates;Benzocycles;INTERMEDIATESOFPALONOSETRONHYDROCHLORIDE | | Mol File: | 1914-65-4.mol |  |
| | 1,2,3,4-Tetrahydro-1-naphthoic acid Chemical Properties |
| Melting point | 75-77°C | | Boiling point | 135°C/5mmHg(lit.) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol, and chloroform. | | pka | 4.28±0.20(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2,(H,12,13) | | InChIKey | VDLWTJCSPSUGOA-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)C2=C(C=CC=C2)CCC1 | | CAS DataBase Reference | 1914-65-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,2,3,4-Tetrahydro-1-naphthoic acid (1914-65-4) |
| Hazard Codes | Xn | | Risk Statements | 22-36-51 | | Safety Statements | 26 | | HS Code | 2916399090 |
| | 1,2,3,4-Tetrahydro-1-naphthoic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 1,2,3,4-Tetrahydro-1-naphthoic acid is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. 1,2,3,4-tetrahydronaphthalene-1-carboxylic acid is a reagent used to produce protease inhibitors. | | Uses | 1,2,3,4-Tetrahydro-1-naphthoic acid is a reagent used to produce protease inhibitors. |
| | 1,2,3,4-Tetrahydro-1-naphthoic acid Preparation Products And Raw materials |
|