|
|
| | METHYL 3-CHLORO-5-IODOBENZOATE Basic information |
| | METHYL 3-CHLORO-5-IODOBENZOATE Chemical Properties |
| Melting point | 41-43°C | | Boiling point | 322.7±27.0 °C(Predicted) | | density | 1.837±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | color | Off-white | | Sensitive | Light Sensitive | | InChI | InChI=1S/C8H6ClIO2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 | | InChIKey | ZDSIXLJPASGHDW-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(I)=CC(Cl)=C1 | | CAS DataBase Reference | 289039-85-6 |
| Provider | Language |
|
ALFA
| English |
| | METHYL 3-CHLORO-5-IODOBENZOATE Usage And Synthesis |
| Uses | Methyl 3-chloro-5-iodobenzoate is an organic heterocyclic compound containing substitutable halogenated elements (chlorine and iodine) in its benzene ring structure. The compound is mainly used as a synthetic intermediate. |
| | METHYL 3-CHLORO-5-IODOBENZOATE Preparation Products And Raw materials |
|