| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | DL-Carnitine-d9 HCl (trimethyl-d9) Basic information |
| Product Name: | DL-Carnitine-d9 HCl (trimethyl-d9) | | Synonyms: | DL-Carnitine-(trimethyl-d9) hydrochloride;[2H9]-DL-Carnitine Chloride;DL-Carnitine-(trimethyl-d9) hydrochloride;D9-DL-carnitine Chloride;Dl-Carnitine-D9 Hcl (Trimethyl-D9) (Standard);DL-Carnitine-d9 HCl (trimethyl-d9) | | CAS: | 1219386-75-0 | | MF: | C7H7ClD9NO3 | | MW: | 206.72 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | DL-Carnitine-d9 HCl (trimethyl-d9) Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMF: 15 mg/ml,DMSO: 20 mg/ml,Ethanol: 25 mg/ml,PBS (pH 7.2): 10 mg/ml | | form | A crystalline solid | | color | White to off-white | | Stability: | Hygroscopic | | InChI | 1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H/i1D3,2D3,3D3; | | InChIKey | JXXCENBLGFBQJM-KYRNGWDOSA-N | | SMILES | [Cl-].[2H]C([2H])([2H])[N+](CC(O)CC(O)=O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DL-Carnitine-d9 HCl (trimethyl-d9) Usage And Synthesis |
| Uses | Vitamin (enzyme cofactor). Essential cofactor of fatty acid metabolism; required for the transport of fatty acids through the inner mitochondrial membrane. Synthetized primarily in the liver and kidney; highest concentrations found in heart and skeletal muscle. Dietary sources include red meat, dairy products, beans, avocado. |
| | DL-Carnitine-d9 HCl (trimethyl-d9) Preparation Products And Raw materials |
|