|
|
| | (S)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate Basic information |
| Product Name: | (S)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate | | Synonyms: | CPD3774-A5;tert-butyl N-[(1S)-4-cyano-2,3-dihydro-1H-inden-1-yl]carbamate;Anti-MS;Carbamic acid,N-[(1S)-4-cyano-2,3-dihydro-1H-inden-1-yl]-, 1,1-dimethylethyl ester;tert-butyl (S)-(4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate;N-[(1S)-4-Cyano-2,3-dihydro-1H-inden-1-yl]carbamic acid 1,1-dimethylethyl ester;OZAN-007;(S)-1-(Boc-amino)-2,3-dihydro-1H-indene-4-carbonitrile | | CAS: | 1306763-31-4 | | MF: | C15H18N2O2 | | MW: | 258.32 | | EINECS: | 815-050-6 | | Product Categories: | | | Mol File: | 1306763-31-4.mol |  |
| | (S)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate Chemical Properties |
| Boiling point | 411.9±44.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.86±0.20(Predicted) | | Appearance | white solid | | InChI | InChI=1S/C15H18N2O2/c1-15(2,3)19-14(18)17-13-8-7-11-10(9-16)5-4-6-12(11)13/h4-6,13H,7-8H2,1-3H3,(H,17,18)/t13-/m0/s1 | | InChIKey | LBHMMDUJKBJVQI-ZDUSSCGKSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C2=C(C(C#N)=CC=C2)CC1 |
| | (S)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate Usage And Synthesis |
| Physical properties | (R)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate is a off-white To White Solid. | | Uses | (R)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate is an amine derivative and can be used as a chiral reagent. |
| | (S)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate Preparation Products And Raw materials |
|