- 4,6-di-tert-butyl-m-cresol
-
- $6.00 / 1KG
-
2025-09-25
- CAS:497-39-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 4,6-tert butyl m-cresol
-
- $0.00 / 20kg
-
2023-11-01
- CAS:497-39-2
- Min. Order: 1000kg
- Purity: 99.9%
- Supply Ability: 5000 tons
|
| | 4,6-Di-tert-butyl-m-cresol Basic information |
| Product Name: | 4,6-Di-tert-butyl-m-cresol | | Synonyms: | 2,4-bis(1,1-dimethylethyl)-5-methylphenol;2,4-bis(1,1-dimethylethyl)-5-methyl-Phenol;dbmc;di-tert-butyl-m-cresol;m-Cresol,4,6-di-tert-butyl-;Phenol,2,4-bis(1,1-dimethylethyl)-5-methyl-;Dibutylcresol;4,6-DI-TERT-BUTYL-META-CRESOL | | CAS: | 497-39-2 | | MF: | C15H24O | | MW: | 220.35 | | EINECS: | 207-847-7 | | Product Categories: | | | Mol File: | 497-39-2.mol |  |
| | 4,6-Di-tert-butyl-m-cresol Chemical Properties |
| Melting point | 62°C | | Boiling point | 284℃ | | density | 0.927 | | refractive index | 1.5021 (estimate) | | Fp | 128℃ | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 11.68±0.23(Predicted) | | form | Solid | | color | Light Yellow to Dark Orange | | Merck | 14,2837 | | InChI | InChI=1S/C15H24O/c1-10-8-13(16)12(15(5,6)7)9-11(10)14(2,3)4/h8-9,16H,1-7H3 | | InChIKey | WYSSJDOPILWQDC-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C)=C(C(C)(C)C)C=C1C(C)(C)C | | CAS DataBase Reference | 497-39-2 | | EPA Substance Registry System | 4,6-Di-tert-butyl-m-cresol (497-39-2) |
| | 4,6-Di-tert-butyl-m-cresol Usage And Synthesis |
| Uses | Intermediate in the production of rubber chemicals modified phenolic resins, synthetic musks of the ambrette type. | | Uses | Condensation of 4,6-Di-tert-butyl-m-cresol can produce regulated food additive di-tert-butyl-m-cresyl phosphonite. |
| | 4,6-Di-tert-butyl-m-cresol Preparation Products And Raw materials |
|