- TRIS(2-ETHYLHEXYL)AMINE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1860-26-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- Tris(2-ethylhexyl)amine
-
- $15.00 / 1KG
-
2021-07-02
- CAS:1860-26-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | TRIS(2-ETHYLHEXYL)AMINE Basic information |
| | TRIS(2-ETHYLHEXYL)AMINE Chemical Properties |
| Boiling point | 120-125 °C(Press: 0.1 Torr) | | density | 0.817 g/mL at 20 °C(lit.) | | vapor pressure | 0.001Pa at 20℃ | | refractive index | n20/D 1.451 | | Fp | 163°C | | form | clear liquid | | pka | 9.32±0.50(Predicted) | | color | Colorless to Light orange to Yellow | | BRN | 2087270 | | Henry's Law Constant | 7.0×10-4 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C24H51N/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3 | | InChIKey | BZUDVELGTZDOIG-UHFFFAOYSA-N | | SMILES | C(N(CC(CC)CCCC)CC(CC)CCCC)C(CC)CCCC | | LogP | 10.13 at 25℃ | | CAS DataBase Reference | 1860-26-0(CAS DataBase Reference) | | EPA Substance Registry System | 1-Hexanamine, 2-ethyl-N,N-bis(2-ethylhexyl)- (1860-26-0) |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50/53 | | Safety Statements | 26-36-61 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2921.19.6190 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B
STOT RE 2 |
| | TRIS(2-ETHYLHEXYL)AMINE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Tris(2-ethylhexyl)amine is a compound used in the extraction and stripping of inorganic acids. | | Flammability and Explosibility | Non flammable |
| | TRIS(2-ETHYLHEXYL)AMINE Preparation Products And Raw materials |
|