diethyl 2,4-dibromopentanedioate manufacturers
|
| | diethyl 2,4-dibromopentanedioate Basic information |
| Product Name: | diethyl 2,4-dibromopentanedioate | | Synonyms: | diethyl alpha,alpha'-dibromoglutarate;diethyl 2,4-dibromopentanedioate;2,4-Dibromo-pentanedioic acid diethyl ester;diethyl 2,4-dibromoglutarate;Pentanedioic acid, 2,4-dibromo-, 1,5-diethyl ester;iethyl2,4-dibromoglutarate | | CAS: | 870-78-0 | | MF: | C9H14Br2O4 | | MW: | 346.01 | | EINECS: | | | Product Categories: | | | Mol File: | 870-78-0.mol |  |
| | diethyl 2,4-dibromopentanedioate Chemical Properties |
| Boiling point | 163-164 °C(Press: 11 Torr) | | density | 1.6042 g/cm3 | | InChI | InChI=1S/C9H14Br2O4/c1-3-14-8(12)6(10)5-7(11)9(13)15-4-2/h6-7H,3-5H2,1-2H3 | | InChIKey | DUSLEJGELFKEAS-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Br)CC(Br)C(OCC)=O |
| | diethyl 2,4-dibromopentanedioate Usage And Synthesis |
| Uses |
Diethyl 2,4-dibromopentanedioate can be used as an important intermediate in organic synthesis.
| | Synthesis |
Diethyl 2,4-dibromoglutarate is synthesized by reacting 2,4-dibromoglutaric acid with anhydrous ethanol in the presence of acetic acid.
|
| | diethyl 2,4-dibromopentanedioate Preparation Products And Raw materials |
|