|
|
| | FMOC-GLU(OTBU)-SER(PSI-ME,MEPRO)-OH Basic information |
| Product Name: | FMOC-GLU(OTBU)-SER(PSI-ME,MEPRO)-OH | | Synonyms: | (9H-Fluoren-9-yl)MethOxy]Carbonyl Glu(OtBu)-SerPsi(Me,Me)Pro-OH;(4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid;Fmoc-Glu(tBu)-Ser[PSI(Me,Me)Pro]-OH;FMOC-GLU(OTBU)-SER(PSI-ME,MEPRO)-OH;(gammaS,4S)-4-Carboxy-gamma-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2,2-dimethyl-delta-oxo-3-oxazolidinepentanoic acid 3-(1,1-dimethylethyl) ester;(S)-3-[Nα-(9-Fluorenylmethyloxycarbonyl)-L-glutamyl-tert-butyl ester]-2,2-dimethyloxazolidine-4-carboxylic acid;Fmoc-Glu(OtBu)-Ser[Psi(Me,Me)Pro]-OH≥ 99% (HPLC);Fmoc-Glu(OtBu)-Ser[Ψ(Me,Me)Pro]-OH | | CAS: | 909115-33-9 | | MF: | C30H36N2O8 | | MW: | 552.62 | | EINECS: | | | Product Categories: | peptide | | Mol File: | Mol File |  |
| | FMOC-GLU(OTBU)-SER(PSI-ME,MEPRO)-OH Chemical Properties |
| Boiling point | 759.9±60.0 °C(Predicted) | | density | 1.250±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | pka | 3.08±0.40(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChIKey | WAUMVPSFQMJIMN-KCHLEUMXSA-N | | SMILES | C1(COC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)N[C@@H](CO)C(C)(C)N2CCC[C@H]2C(=O)O)C2C=CC=CC=2C2C=CC=CC1=2 |
| WGK Germany | WGK 2 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-GLU(OTBU)-SER(PSI-ME,MEPRO)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-GLU(OTBU)-SER(PSI-ME,MEPRO)-OH Preparation Products And Raw materials |
|