- Z-D-Lys(Boc)-OH
-
- $0.00 / 25KG
-
2025-06-27
- CAS:66845-42-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Z-D-Lys(Boc)-OH
-
- $15.00 / 1kg
-
2025-06-20
- CAS:66845-42-9
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | N-Benzyloxycarbonyl-N'-(tert-Butoxycarbonyl)-L-lysine Basic information |
| | N-Benzyloxycarbonyl-N'-(tert-Butoxycarbonyl)-L-lysine Chemical Properties |
| Melting point | 61-63°C | | Boiling point | 587.0±50.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.98±0.21(Predicted) | | form | <61°C Solid,>63°C Liquid | | color | Colorless to light yellow | | BRN | 5310107 | | Major Application | peptide synthesis | | InChI | 1S/C19H28N2O6/c1-19(2,3)27-17(24)20-12-8-7-11-15(16(22)23)21-18(25)26-13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,20,24)(H,21,25)(H,22,23)/t15-/m1/s1 | | InChIKey | DYSBKEOCHROEGX-OAHLLOKOSA-N | | SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](NC(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 66845-42-9(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-Benzyloxycarbonyl-N'-(tert-Butoxycarbonyl)-L-lysine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow oil | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Benzyloxycarbonyl-N'-(tert-Butoxycarbonyl)-L-lysine Preparation Products And Raw materials |
|