- Momelotinib HCl
-
- $1520.00
-
2026-07-27
- CAS:1380317-28-1
- Purity:
- Supply Ability: 10g
|
| | Momelotinib Dihydrochloride Basic information |
| Product Name: | Momelotinib Dihydrochloride | | Synonyms: | Momelotinib Dihydrochloride;Momelotinib 2HCl;Momelotinib HCl;N-(Cyanomethyl)-4-(2-((4-morpholinophenyl)amino)pyrimidin-4-yl)benzamide dihydrochloride;Cyt387.HCl;N-(Cyanomethyl)-4-(2-{[4-(4-morpholinyl)phenyl]amino}-4-pyrimidinyl)benzamide.HCl;Momelotinib 2HC;Momelotinib Dihydrochloride Monohydrate | | CAS: | 1380317-28-1 | | MF: | C23H23ClN6O2 | | MW: | 450.93 | | EINECS: | | | Product Categories: | | | Mol File: | 1380317-28-1.mol |  |
| | Momelotinib Dihydrochloride Chemical Properties |
| InChIKey | NGOUSYFDVUVHDA-UHFFFAOYSA-N | | SMILES | N(C1C=CC(N2CCOCC2)=CC=1)C1=NC=CC(C2C=CC(C(=O)NCC#N)=CC=2)=N1.Cl |
| | Momelotinib Dihydrochloride Usage And Synthesis |
| Uses | Momelotinib (dihydrochloride) is a JAK1/JAK2 inhibitor that also antagonizes ACVR1, leading to downregulation of Hepcidin expression and increased availability of iron for erythropoiesis. Momelotinib (dihydrochloride) can reduce transfusion burden and spleen enlargement caused by myelofibrosis, showing potential value in research and application within the field of myelofibrosis[1]. | | IC 50 | JAK1; JAK2 | | References | [1] Tremblay D, et al. Momelotinib for the treatment of myelofibrosis with anemia. Future Oncol. 2022 Jun;18(20):2559-2571. DOI:10.2217/fon-2022-0276 |
| | Momelotinib Dihydrochloride Preparation Products And Raw materials |
|