|
|
| | 1-Phenylmethyl-5-phenyl-barbituric acid Basic information |
| Product Name: | 1-Phenylmethyl-5-phenyl-barbituric acid | | Synonyms: | 1-PHENYLMETHYL-5-PHENYL-BARBITURIC ACID;SODIUM1-BENZYL-5-PHENYLBARBITURICACID;1-BENZYL-5-PHENYLBARBITURIC ACID;BENZYL-5-PHENYLBARBITURIC ACID;LABOTEST-BB LT00454619;6(1h,3h,5h)-pyrimidinetrione,5-phenyl-1-(phenylmethyl)-4;1-Benzyl-5-phenyl-1-barbituric acid;1-Benzyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione | | CAS: | 72846-00-5 | | MF: | C17H14N2O3 | | MW: | 294.3 | | EINECS: | 276-940-2 | | Product Categories: | | | Mol File: | 72846-00-5.mol |  |
| | 1-Phenylmethyl-5-phenyl-barbituric acid Chemical Properties |
| Melting point | 163-165°C | | density | 1.304±0.06 g/cm3(Predicted) | | pka | 4.29±0.20(Predicted) | | Water Solubility | Soluble in acetone. Slightly soluble in water. | | InChI | InChI=1S/C17H14N2O3/c20-15-14(13-9-5-2-6-10-13)16(21)19(17(22)18-15)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,18,20,22) | | InChIKey | KCWWCWMGJOWTMY-UHFFFAOYSA-N | | SMILES | C1(=O)N(CC2=CC=CC=C2)C(=O)C(C2=CC=CC=C2)C(=O)N1 | | LogP | 2.3 at 20℃ | | CAS DataBase Reference | 72846-00-5(CAS DataBase Reference) | | EPA Substance Registry System | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-phenyl-1-(phenylmethyl)- (72846-00-5) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 22-24/25-45 | | TSCA | TSCA listed |
| Provider | Language |
|
ALFA
| English |
| | 1-Phenylmethyl-5-phenyl-barbituric acid Usage And Synthesis |
| Uses | 1-Benzyl-5-phenylbarbituric acid is useful as a pharmaceutical intermediate in organic synthesis. |
| | 1-Phenylmethyl-5-phenyl-barbituric acid Preparation Products And Raw materials |
|